C24H21NO5S — CID 29126715
3-(3,4-dimethoxyphenyl)-9-(thiophen-2-ylmethyl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 29126715) has the molecular formula C24H21NO5S and a molecular weight of 435.50 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-9-(thiophen-2-ylmethyl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-9-(thiophen-2-ylmethyl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 29126715 |
| Molecular Formula | C24H21NO5S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-9-(thiophen-2-ylmethyl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | COc1ccc(-c2cc3ccc4c(c3oc2=O)CN(Cc2cccs2)CO4)cc1OC |
| InChI | InChI=1S/C24H21NO5S/c1-27-21-8-5-15(11-22(21)28-2)18-10-16-6-7-20-19(23(16)30-24(18)26)13-25(14-29-20)12-17-4-3-9-31-17/h3-11H,12-14H2,1-2H3 |
| InChIKey | MBLUSSHKONQICR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|