C23H23N5O3S — CID 29126728
7-morpholin-4-yl-13-(2-phenoxyethyl)-10-thia-8,13,14,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),14-pentaen-12-one (PubChem CID 29126728) has the molecular formula C23H23N5O3S and a molecular weight of 449.54 g/mol. Its IUPAC name is 7-morpholin-4-yl-13-(2-phenoxyethyl)-10-thia-8,13,14,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),14-pentaen-12-one.
| Compound Name | 7-morpholin-4-yl-13-(2-phenoxyethyl)-10-thia-8,13,14,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),14-pentaen-12-one |
|---|---|
| PubChem CID | 29126728 |
| Molecular Formula | C23H23N5O3S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 7-morpholin-4-yl-13-(2-phenoxyethyl)-10-thia-8,13,14,15-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2(6),7,11(16),14-pentaen-12-one |
| SMILES | O=c1c2sc3nc(N4CCOCC4)c4c(c3c2nnn1CCOc1ccccc1)CCC4 |
| InChI | InChI=1S/C23H23N5O3S/c29-23-20-19(25-26-28(23)11-14-31-15-5-2-1-3-6-15)18-16-7-4-8-17(16)21(24-22(18)32-20)27-9-12-30-13-10-27/h1-3,5-6H,4,7-14H2 |
| InChIKey | BQBQXIDIEMNAEN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |