C14H15N3O3S — CID 29128414
methyl 5-(4-phenylbutanoylamino)thiadiazole-4-carboxylate (PubChem CID 29128414) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is methyl 5-(4-phenylbutanoylamino)thiadiazole-4-carboxylate.
| Compound Name | methyl 5-(4-phenylbutanoylamino)thiadiazole-4-carboxylate |
|---|---|
| PubChem CID | 29128414 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | methyl 5-(4-phenylbutanoylamino)thiadiazole-4-carboxylate |
| SMILES | COC(=O)c1nnsc1NC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C14H15N3O3S/c1-20-14(19)12-13(21-17-16-12)15-11(18)9-5-8-10-6-3-2-4-7-10/h2-4,6-7H,5,8-9H2,1H3,(H,15,18) |
| InChIKey | TXMMXUGPCMDJGJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |