About 2-fluoro-N-[3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]benzamide
2-fluoro-N-[3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]benzamide (PubChem CID 29128669) has the molecular formula C19H12FN3O2
and a molecular weight of 333.32 g/mol. Its IUPAC name is 2-fluoro-N-[3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]benzamide.
Molecular Properties
| Compound Name | 2-fluoro-N-[3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]benzamide |
| PubChem CID | 29128669 |
| Molecular Formula | C19H12FN3O2 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-fluoro-N-[3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2nc3cnccc3o2)c1)c1ccccc1F |
| InChI | InChI=1S/C19H12FN3O2/c20-15-7-2-1-6-14(15)18(24)22-13-5-3-4-12(10-13)19-23-16-11-21-9-8-17(16)25-19/h1-11H,(H,22,24) |
| InChIKey | NOVCJHIJZMFFKY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-N-[3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-[3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]benzamide?
The IUPAC name of 2-fluoro-N-[3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]benzamide (CID 29128669) is 2-fluoro-N-[3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]benzamide.
What is the SMILES notation for 2-fluoro-N-[3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]benzamide?
The canonical SMILES for 2-fluoro-N-[3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]benzamide is O=C(Nc1cccc(-c2nc3cnccc3o2)c1)c1ccccc1F.
What is the InChIKey of 2-fluoro-N-[3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]benzamide?
The InChIKey is NOVCJHIJZMFFKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12FN3O2/c20-15-7-2-1-6-14(15)18(24)22-13-5-3-4-12(10-13)19-23-16-11-21-9-8-17(16)25-19/h1-11H,(H,22,24).
What are the key properties of 2-fluoro-N-[3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]benzamide?
2-fluoro-N-[3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]benzamide has a molecular weight of 333.32 g/mol, XLogP of 4.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-[3-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]benzamide is sourced from PubChem (CID 29128669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).