About 1-piperidin-1-ylpropan-2-yl 4-ethoxybenzoate;hydrochloride
1-piperidin-1-ylpropan-2-yl 4-ethoxybenzoate;hydrochloride (PubChem CID 2913384) has the molecular formula C17H26ClNO3
and a molecular weight of 327.85 g/mol. Its IUPAC name is 1-piperidin-1-ylpropan-2-yl 4-ethoxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | 1-piperidin-1-ylpropan-2-yl 4-ethoxybenzoate;hydrochloride |
| PubChem CID | 2913384 |
| Molecular Formula | C17H26ClNO3 |
| Molecular Weight | 327.85 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-piperidin-1-ylpropan-2-yl 4-ethoxybenzoate;hydrochloride |
| SMILES | CCOc1ccc(C(=O)OC(C)CN2CCCCC2)cc1.Cl |
| InChI | InChI=1S/C17H25NO3.ClH/c1-3-20-16-9-7-15(8-10-16)17(19)21-14(2)13-18-11-5-4-6-12-18;/h7-10,14H,3-6,11-13H2,1-2H3;1H |
| InChIKey | DPANRFFGZNCUSJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.85 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-piperidin-1-ylpropan-2-yl 4-ethoxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-1-ylpropan-2-yl 4-ethoxybenzoate;hydrochloride?
The IUPAC name of 1-piperidin-1-ylpropan-2-yl 4-ethoxybenzoate;hydrochloride (CID 2913384) is 1-piperidin-1-ylpropan-2-yl 4-ethoxybenzoate;hydrochloride.
What is the SMILES notation for 1-piperidin-1-ylpropan-2-yl 4-ethoxybenzoate;hydrochloride?
The canonical SMILES for 1-piperidin-1-ylpropan-2-yl 4-ethoxybenzoate;hydrochloride is CCOc1ccc(C(=O)OC(C)CN2CCCCC2)cc1.Cl.
What is the InChIKey of 1-piperidin-1-ylpropan-2-yl 4-ethoxybenzoate;hydrochloride?
The InChIKey is DPANRFFGZNCUSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO3.ClH/c1-3-20-16-9-7-15(8-10-16)17(19)21-14(2)13-18-11-5-4-6-12-18;/h7-10,14H,3-6,11-13H2,1-2H3;1H.
What are the key properties of 1-piperidin-1-ylpropan-2-yl 4-ethoxybenzoate;hydrochloride?
1-piperidin-1-ylpropan-2-yl 4-ethoxybenzoate;hydrochloride has a molecular weight of 327.85 g/mol, XLogP of 3.54, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-1-ylpropan-2-yl 4-ethoxybenzoate;hydrochloride is sourced from PubChem (CID 2913384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).