C23H24N2O3 — CID 29133842
(3R)-1-[3-(2-phenylindol-1-yl)propanoyl]piperidine-3-carboxylic acid (PubChem CID 29133842) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is (3R)-1-[3-(2-phenylindol-1-yl)propanoyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[3-(2-phenylindol-1-yl)propanoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 29133842 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (3R)-1-[3-(2-phenylindol-1-yl)propanoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN(C(=O)CCn2c(-c3ccccc3)cc3ccccc32)C1 |
| InChI | InChI=1S/C23H24N2O3/c26-22(24-13-6-10-19(16-24)23(27)28)12-14-25-20-11-5-4-9-18(20)15-21(25)17-7-2-1-3-8-17/h1-5,7-9,11,15,19H,6,10,12-14,16H2,(H,27,28)/t19-/m1/s1 |
| InChIKey | UBYMRVLPRGOMHQ-LJQANCHMSA-N |
| XLogP | 4.02 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |