C18H20N4O — CID 29134829
2-methoxy-5-(1,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]benzimidazol-2-yl)aniline (PubChem CID 29134829) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is 2-methoxy-5-(1,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]benzimidazol-2-yl)aniline.
| Compound Name | 2-methoxy-5-(1,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]benzimidazol-2-yl)aniline |
|---|---|
| PubChem CID | 29134829 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-methoxy-5-(1,3,4,5-tetrahydro-[1,4]diazepino[1,2-a]benzimidazol-2-yl)aniline |
| SMILES | COc1ccc(N2CCCn3c(nc4ccccc43)C2)cc1N |
| InChI | InChI=1S/C18H20N4O/c1-23-17-8-7-13(11-14(17)19)21-9-4-10-22-16-6-3-2-5-15(16)20-18(22)12-21/h2-3,5-8,11H,4,9-10,12,19H2,1H3 |
| InChIKey | PGESBBTUVMURPG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|