C22H14FNO3S — CID 29135884
6-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-2,3-dimethylfuro[3,2-g]chromen-7-one (PubChem CID 29135884) has the molecular formula C22H14FNO3S and a molecular weight of 391.42 g/mol. Its IUPAC name is 6-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-2,3-dimethylfuro[3,2-g]chromen-7-one.
| Compound Name | 6-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-2,3-dimethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 29135884 |
| Molecular Formula | C22H14FNO3S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 6-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-2,3-dimethylfuro[3,2-g]chromen-7-one |
| SMILES | Cc1oc2cc3oc(=O)c(-c4csc(-c5ccc(F)cc5)n4)cc3cc2c1C |
| InChI | InChI=1S/C22H14FNO3S/c1-11-12(2)26-20-9-19-14(7-16(11)20)8-17(22(25)27-19)18-10-28-21(24-18)13-3-5-15(23)6-4-13/h3-10H,1-2H3 |
| InChIKey | BTDSEXJMSHECBR-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|