C18H17N5O3S2 — CID 29136512
N-[2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)ethyl]-1-methylindole-2-carboxamide (PubChem CID 29136512) has the molecular formula C18H17N5O3S2 and a molecular weight of 415.50 g/mol. Its IUPAC name is N-[2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)ethyl]-1-methylindole-2-carboxamide.
| Compound Name | N-[2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)ethyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 29136512 |
| Molecular Formula | C18H17N5O3S2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | N-[2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)ethyl]-1-methylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)NCCNS(=O)(=O)c2cccc3nsnc23)cc2ccccc21 |
| InChI | InChI=1S/C18H17N5O3S2/c1-23-14-7-3-2-5-12(14)11-15(23)18(24)19-9-10-20-28(25,26)16-8-4-6-13-17(16)22-27-21-13/h2-8,11,20H,9-10H2,1H3,(H,19,24) |
| InChIKey | NMHWAXIFMVXOKO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|