C19H20N2O5 — CID 29137137
(3R)-1-(2,4-dimethoxyphenyl)-N-(4-hydroxyphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 29137137) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is (3R)-1-(2,4-dimethoxyphenyl)-N-(4-hydroxyphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(2,4-dimethoxyphenyl)-N-(4-hydroxyphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 29137137 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (3R)-1-(2,4-dimethoxyphenyl)-N-(4-hydroxyphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(N2C[C@H](C(=O)Nc3ccc(O)cc3)CC2=O)c(OC)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-25-15-7-8-16(17(10-15)26-2)21-11-12(9-18(21)23)19(24)20-13-3-5-14(22)6-4-13/h3-8,10,12,22H,9,11H2,1-2H3,(H,20,24)/t12-/m1/s1 |
| InChIKey | MVRHAXXHHJIHIG-GFCCVEGCSA-N |
| XLogP | 2.40 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|