About 1-morpholin-4-ylpropan-2-yl 3-bromobenzoate;hydrochloride
1-morpholin-4-ylpropan-2-yl 3-bromobenzoate;hydrochloride (PubChem CID 2913746) has the molecular formula C14H19BrClNO3
and a molecular weight of 364.67 g/mol. Its IUPAC name is 1-morpholin-4-ylpropan-2-yl 3-bromobenzoate;hydrochloride.
Molecular Properties
| Compound Name | 1-morpholin-4-ylpropan-2-yl 3-bromobenzoate;hydrochloride |
| PubChem CID | 2913746 |
| Molecular Formula | C14H19BrClNO3 |
| Molecular Weight | 364.67 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 1-morpholin-4-ylpropan-2-yl 3-bromobenzoate;hydrochloride |
| SMILES | CC(CN1CCOCC1)OC(=O)c1cccc(Br)c1.Cl |
| InChI | InChI=1S/C14H18BrNO3.ClH/c1-11(10-16-5-7-18-8-6-16)19-14(17)12-3-2-4-13(15)9-12;/h2-4,9,11H,5-8,10H2,1H3;1H |
| InChIKey | XLDYHYNYTNFMKS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.67 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-morpholin-4-ylpropan-2-yl 3-bromobenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-ylpropan-2-yl 3-bromobenzoate;hydrochloride?
The IUPAC name of 1-morpholin-4-ylpropan-2-yl 3-bromobenzoate;hydrochloride (CID 2913746) is 1-morpholin-4-ylpropan-2-yl 3-bromobenzoate;hydrochloride.
What is the SMILES notation for 1-morpholin-4-ylpropan-2-yl 3-bromobenzoate;hydrochloride?
The canonical SMILES for 1-morpholin-4-ylpropan-2-yl 3-bromobenzoate;hydrochloride is CC(CN1CCOCC1)OC(=O)c1cccc(Br)c1.Cl.
What is the InChIKey of 1-morpholin-4-ylpropan-2-yl 3-bromobenzoate;hydrochloride?
The InChIKey is XLDYHYNYTNFMKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrNO3.ClH/c1-11(10-16-5-7-18-8-6-16)19-14(17)12-3-2-4-13(15)9-12;/h2-4,9,11H,5-8,10H2,1H3;1H.
What are the key properties of 1-morpholin-4-ylpropan-2-yl 3-bromobenzoate;hydrochloride?
1-morpholin-4-ylpropan-2-yl 3-bromobenzoate;hydrochloride has a molecular weight of 364.67 g/mol, XLogP of 2.75, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-ylpropan-2-yl 3-bromobenzoate;hydrochloride is sourced from PubChem (CID 2913746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).