C25H28ClN5O2 — CID 29139165
6-chloro-N-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 29139165) has the molecular formula C25H28ClN5O2 and a molecular weight of 465.99 g/mol. Its IUPAC name is 6-chloro-N-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | 6-chloro-N-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 29139165 |
| Molecular Formula | C25H28ClN5O2 |
| Molecular Weight | 465.99 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 6-chloro-N-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | O=C(CCNC(=O)N1CCc2c([nH]c3ccc(Cl)cc23)C1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H28ClN5O2/c26-18-6-7-22-21(16-18)20-9-11-31(17-23(20)28-22)25(33)27-10-8-24(32)30-14-12-29(13-15-30)19-4-2-1-3-5-19/h1-7,16,28H,8-15,17H2,(H,27,33) |
| InChIKey | ZRIVUQKFYHIPLL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.99 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|