C15H20N4O2 — CID 29139236
2-(3-methoxypropyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-8-carboxamide (PubChem CID 29139236) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-8-carboxamide.
| Compound Name | 2-(3-methoxypropyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-8-carboxamide |
|---|---|
| PubChem CID | 29139236 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-(3-methoxypropyl)-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-8-carboxamide |
| SMILES | COCCCN1CCn2c(nc3cc(C(N)=O)ccc32)C1 |
| InChI | InChI=1S/C15H20N4O2/c1-21-8-2-5-18-6-7-19-13-4-3-11(15(16)20)9-12(13)17-14(19)10-18/h3-4,9H,2,5-8,10H2,1H3,(H2,16,20) |
| InChIKey | VBCBCVRIVGRVIY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|