C20H13NO3S — CID 2913952
5-[(2-prop-2-ynoxynaphthalen-1-yl)methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione (PubChem CID 2913952) has the molecular formula C20H13NO3S and a molecular weight of 347.40 g/mol. Its IUPAC name is 5-[(2-prop-2-ynoxynaphthalen-1-yl)methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(2-prop-2-ynoxynaphthalen-1-yl)methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2913952 |
| Molecular Formula | C20H13NO3S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 5-[(2-prop-2-ynoxynaphthalen-1-yl)methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione |
| SMILES | C#CCOc1ccc2ccccc2c1C=C1SC(=O)N(CC#C)C1=O |
| InChI | InChI=1S/C20H13NO3S/c1-3-11-21-19(22)18(25-20(21)23)13-16-15-8-6-5-7-14(15)9-10-17(16)24-12-4-2/h1-2,5-10,13H,11-12H2 |
| InChIKey | IQHVYIWZLMTHOP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|