About (2S)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-(7-methoxy-1H-indol-3-yl)acetic acid
(2S)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-(7-methoxy-1H-indol-3-yl)acetic acid (PubChem CID 29140751) has the molecular formula C23H22FN3O4
and a molecular weight of 423.44 g/mol. Its IUPAC name is (2S)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-(7-methoxy-1H-indol-3-yl)acetic acid.
Molecular Properties
| Compound Name | (2S)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-(7-methoxy-1H-indol-3-yl)acetic acid |
| PubChem CID | 29140751 |
| Molecular Formula | C23H22FN3O4 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (2S)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-(7-methoxy-1H-indol-3-yl)acetic acid |
| SMILES | COc1cccc2c([C@@H](C(=O)O)N3CCC(c4noc5cc(F)ccc45)CC3)c[nH]c12 |
| InChI | InChI=1S/C23H22FN3O4/c1-30-18-4-2-3-15-17(12-25-21(15)18)22(23(28)29)27-9-7-13(8-10-27)20-16-6-5-14(24)11-19(16)31-26-20/h2-6,11-13,22,25H,7-10H2,1H3,(H,28,29)/t22-/m0/s1 |
| InChIKey | OMVHCACLSCRTGD-QFIPXVFZSA-N |
| XLogP | 4.46 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-(7-methoxy-1H-indol-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-(7-methoxy-1H-indol-3-yl)acetic acid?
The IUPAC name of (2S)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-(7-methoxy-1H-indol-3-yl)acetic acid (CID 29140751) is (2S)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-(7-methoxy-1H-indol-3-yl)acetic acid.
What is the SMILES notation for (2S)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-(7-methoxy-1H-indol-3-yl)acetic acid?
The canonical SMILES for (2S)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-(7-methoxy-1H-indol-3-yl)acetic acid is COc1cccc2c([C@@H](C(=O)O)N3CCC(c4noc5cc(F)ccc45)CC3)c[nH]c12.
What is the InChIKey of (2S)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-(7-methoxy-1H-indol-3-yl)acetic acid?
The InChIKey is OMVHCACLSCRTGD-QFIPXVFZSA-N. The full InChI is InChI=1S/C23H22FN3O4/c1-30-18-4-2-3-15-17(12-25-21(15)18)22(23(28)29)27-9-7-13(8-10-27)20-16-6-5-14(24)11-19(16)31-26-20/h2-6,11-13,22,25H,7-10H2,1H3,(H,28,29)/t22-/m0/s1.
What are the key properties of (2S)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-(7-methoxy-1H-indol-3-yl)acetic acid?
(2S)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-(7-methoxy-1H-indol-3-yl)acetic acid has a molecular weight of 423.44 g/mol, XLogP of 4.46, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-(7-methoxy-1H-indol-3-yl)acetic acid is sourced from PubChem (CID 29140751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).