C19H24O4 — CID 2914139
3,3,5,5-tetramethyl-6-(2,4,6-trimethylbenzoyl)oxane-2,4-dione (PubChem CID 2914139) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-6-(2,4,6-trimethylbenzoyl)oxane-2,4-dione.
| Compound Name | 3,3,5,5-tetramethyl-6-(2,4,6-trimethylbenzoyl)oxane-2,4-dione |
|---|---|
| PubChem CID | 2914139 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 3,3,5,5-tetramethyl-6-(2,4,6-trimethylbenzoyl)oxane-2,4-dione |
| SMILES | Cc1cc(C)c(C(=O)C2OC(=O)C(C)(C)C(=O)C2(C)C)c(C)c1 |
| InChI | InChI=1S/C19H24O4/c1-10-8-11(2)13(12(3)9-10)14(20)15-18(4,5)16(21)19(6,7)17(22)23-15/h8-9,15H,1-7H3 |
| InChIKey | WUASPLVLCIJDLS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|