C14H25N3OS — CID 2914170
N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-ethylhexanamide (PubChem CID 2914170) has the molecular formula C14H25N3OS and a molecular weight of 283.44 g/mol. Its IUPAC name is N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-ethylhexanamide.
| Compound Name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-ethylhexanamide |
|---|---|
| PubChem CID | 2914170 |
| Molecular Formula | C14H25N3OS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-ethylhexanamide |
| SMILES | CCCCC(CC)C(=O)Nc1nnc(C(C)(C)C)s1 |
| InChI | InChI=1S/C14H25N3OS/c1-6-8-9-10(7-2)11(18)15-13-17-16-12(19-13)14(3,4)5/h10H,6-9H2,1-5H3,(H,15,17,18) |
| InChIKey | WQILCYDRJYFHAV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |