About [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate (PubChem CID 29142457) has the molecular formula C19H18BrF2NO4S
and a molecular weight of 474.32 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate.
Molecular Properties
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate |
| PubChem CID | 29142457 |
| Molecular Formula | C19H18BrF2NO4S |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 473.01 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate |
| SMILES | Cc1cc(SCC(=O)OCC(=O)Nc2ccccc2OC(F)F)c(C)cc1Br |
| InChI | InChI=1S/C19H18BrF2NO4S/c1-11-8-16(12(2)7-13(11)20)28-10-18(25)26-9-17(24)23-14-5-3-4-6-15(14)27-19(21)22/h3-8,19H,9-10H2,1-2H3,(H,23,24) |
| InChIKey | KZANBVTYUVSWJH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate?
The IUPAC name of [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate (CID 29142457) is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate.
What is the SMILES notation for [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate?
The canonical SMILES for [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate is Cc1cc(SCC(=O)OCC(=O)Nc2ccccc2OC(F)F)c(C)cc1Br.
What is the InChIKey of [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate?
The InChIKey is KZANBVTYUVSWJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18BrF2NO4S/c1-11-8-16(12(2)7-13(11)20)28-10-18(25)26-9-17(24)23-14-5-3-4-6-15(14)27-19(21)22/h3-8,19H,9-10H2,1-2H3,(H,23,24).
What are the key properties of [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate?
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate has a molecular weight of 474.32 g/mol, XLogP of 4.94, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate is sourced from PubChem (CID 29142457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).