About 1-piperidin-1-yl-3-(2,4,6-trichlorophenoxy)propan-2-ol
1-piperidin-1-yl-3-(2,4,6-trichlorophenoxy)propan-2-ol (PubChem CID 2914648) has the molecular formula C14H18Cl3NO2
and a molecular weight of 338.66 g/mol. Its IUPAC name is 1-piperidin-1-yl-3-(2,4,6-trichlorophenoxy)propan-2-ol.
Molecular Properties
| Compound Name | 1-piperidin-1-yl-3-(2,4,6-trichlorophenoxy)propan-2-ol |
| PubChem CID | 2914648 |
| Molecular Formula | C14H18Cl3NO2 |
| Molecular Weight | 338.66 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 1-piperidin-1-yl-3-(2,4,6-trichlorophenoxy)propan-2-ol |
| SMILES | OC(COc1c(Cl)cc(Cl)cc1Cl)CN1CCCCC1 |
| InChI | InChI=1S/C14H18Cl3NO2/c15-10-6-12(16)14(13(17)7-10)20-9-11(19)8-18-4-2-1-3-5-18/h6-7,11,19H,1-5,8-9H2 |
| InChIKey | PARURLGTYFRKCK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.66 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-piperidin-1-yl-3-(2,4,6-trichlorophenoxy)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-1-yl-3-(2,4,6-trichlorophenoxy)propan-2-ol?
The IUPAC name of 1-piperidin-1-yl-3-(2,4,6-trichlorophenoxy)propan-2-ol (CID 2914648) is 1-piperidin-1-yl-3-(2,4,6-trichlorophenoxy)propan-2-ol.
What is the SMILES notation for 1-piperidin-1-yl-3-(2,4,6-trichlorophenoxy)propan-2-ol?
The canonical SMILES for 1-piperidin-1-yl-3-(2,4,6-trichlorophenoxy)propan-2-ol is OC(COc1c(Cl)cc(Cl)cc1Cl)CN1CCCCC1.
What is the InChIKey of 1-piperidin-1-yl-3-(2,4,6-trichlorophenoxy)propan-2-ol?
The InChIKey is PARURLGTYFRKCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18Cl3NO2/c15-10-6-12(16)14(13(17)7-10)20-9-11(19)8-18-4-2-1-3-5-18/h6-7,11,19H,1-5,8-9H2.
What are the key properties of 1-piperidin-1-yl-3-(2,4,6-trichlorophenoxy)propan-2-ol?
1-piperidin-1-yl-3-(2,4,6-trichlorophenoxy)propan-2-ol has a molecular weight of 338.66 g/mol, XLogP of 3.87, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-1-yl-3-(2,4,6-trichlorophenoxy)propan-2-ol is sourced from PubChem (CID 2914648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).