C23H22N4O3 — CID 29146918
N-[4-[(3R)-2,5-dioxo-3-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pyrrolidin-1-yl]phenyl]acetamide (PubChem CID 29146918) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is N-[4-[(3R)-2,5-dioxo-3-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[(3R)-2,5-dioxo-3-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 29146918 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[4-[(3R)-2,5-dioxo-3-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pyrrolidin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)C[C@@H](N3CCc4[nH]c5ccccc5c4C3)C2=O)cc1 |
| InChI | InChI=1S/C23H22N4O3/c1-14(28)24-15-6-8-16(9-7-15)27-22(29)12-21(23(27)30)26-11-10-20-18(13-26)17-4-2-3-5-19(17)25-20/h2-9,21,25H,10-13H2,1H3,(H,24,28)/t21-/m1/s1 |
| InChIKey | FLBMJUNHENUBHM-OAQYLSRUSA-N |
| XLogP | 2.82 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|