About 3-methyl-6-(2-methyl-1,3-thiazol-4-yl)furo[3,2-g]chromen-7-one
3-methyl-6-(2-methyl-1,3-thiazol-4-yl)furo[3,2-g]chromen-7-one (PubChem CID 29147891) has the molecular formula C16H11NO3S
and a molecular weight of 297.34 g/mol. Its IUPAC name is 3-methyl-6-(2-methyl-1,3-thiazol-4-yl)furo[3,2-g]chromen-7-one.
Molecular Properties
| Compound Name | 3-methyl-6-(2-methyl-1,3-thiazol-4-yl)furo[3,2-g]chromen-7-one |
| PubChem CID | 29147891 |
| Molecular Formula | C16H11NO3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 3-methyl-6-(2-methyl-1,3-thiazol-4-yl)furo[3,2-g]chromen-7-one |
| SMILES | Cc1nc(-c2cc3cc4c(C)coc4cc3oc2=O)cs1 |
| InChI | InChI=1S/C16H11NO3S/c1-8-6-19-15-5-14-10(3-11(8)15)4-12(16(18)20-14)13-7-21-9(2)17-13/h3-7H,1-2H3 |
| InChIKey | AEEXYXHYLSUECA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-6-(2-methyl-1,3-thiazol-4-yl)furo[3,2-g]chromen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-(2-methyl-1,3-thiazol-4-yl)furo[3,2-g]chromen-7-one?
The IUPAC name of 3-methyl-6-(2-methyl-1,3-thiazol-4-yl)furo[3,2-g]chromen-7-one (CID 29147891) is 3-methyl-6-(2-methyl-1,3-thiazol-4-yl)furo[3,2-g]chromen-7-one.
What is the SMILES notation for 3-methyl-6-(2-methyl-1,3-thiazol-4-yl)furo[3,2-g]chromen-7-one?
The canonical SMILES for 3-methyl-6-(2-methyl-1,3-thiazol-4-yl)furo[3,2-g]chromen-7-one is Cc1nc(-c2cc3cc4c(C)coc4cc3oc2=O)cs1.
What is the InChIKey of 3-methyl-6-(2-methyl-1,3-thiazol-4-yl)furo[3,2-g]chromen-7-one?
The InChIKey is AEEXYXHYLSUECA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO3S/c1-8-6-19-15-5-14-10(3-11(8)15)4-12(16(18)20-14)13-7-21-9(2)17-13/h3-7H,1-2H3.
What are the key properties of 3-methyl-6-(2-methyl-1,3-thiazol-4-yl)furo[3,2-g]chromen-7-one?
3-methyl-6-(2-methyl-1,3-thiazol-4-yl)furo[3,2-g]chromen-7-one has a molecular weight of 297.34 g/mol, XLogP of 4.28, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-(2-methyl-1,3-thiazol-4-yl)furo[3,2-g]chromen-7-one is sourced from PubChem (CID 29147891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).