C28H32N2O4 — CID 29148256
9-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-(2-methoxyphenyl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-4-one (PubChem CID 29148256) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is 9-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-(2-methoxyphenyl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-4-one.
| Compound Name | 9-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-(2-methoxyphenyl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-4-one |
|---|---|
| PubChem CID | 29148256 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 9-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-(2-methoxyphenyl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-4-one |
| SMILES | COc1ccccc1-c1coc2c3c(ccc2c1=O)OCN(C[C@@H]1CCCN2CCCC[C@H]12)C3 |
| InChI | InChI=1S/C28H32N2O4/c1-32-25-10-3-2-8-20(25)23-17-33-28-21(27(23)31)11-12-26-22(28)16-29(18-34-26)15-19-7-6-14-30-13-5-4-9-24(19)30/h2-3,8,10-12,17,19,24H,4-7,9,13-16,18H2,1H3/t19-,24+/m0/s1 |
| InChIKey | BDSJHIMDFHDIKI-YADARESESA-N |
| XLogP | 4.89 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |