C26H29N3O4 — CID 29148772
propan-2-yl 2-[3-[(Z)-[(4-ethoxybenzoyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 29148772) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is propan-2-yl 2-[3-[(Z)-[(4-ethoxybenzoyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | propan-2-yl 2-[3-[(Z)-[(4-ethoxybenzoyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 29148772 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | propan-2-yl 2-[3-[(Z)-[(4-ethoxybenzoyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | CCOc1ccc(C(=O)N/N=C\c2cc(C)n(-c3ccccc3C(=O)OC(C)C)c2C)cc1 |
| InChI | InChI=1S/C26H29N3O4/c1-6-32-22-13-11-20(12-14-22)25(30)28-27-16-21-15-18(4)29(19(21)5)24-10-8-7-9-23(24)26(31)33-17(2)3/h7-17H,6H2,1-5H3,(H,28,30)/b27-16- |
| InChIKey | GRQDMPUYTHTTLW-YUMHPJSZSA-N |
| XLogP | 4.82 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|