C24H23FN2O3S — CID 29148983
1-(4-fluorobenzoyl)-N-[(1R)-1-phenylethyl]-3,4-dihydro-2H-quinoline-6-sulfonamide (PubChem CID 29148983) has the molecular formula C24H23FN2O3S and a molecular weight of 438.52 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)-N-[(1R)-1-phenylethyl]-3,4-dihydro-2H-quinoline-6-sulfonamide.
| Compound Name | 1-(4-fluorobenzoyl)-N-[(1R)-1-phenylethyl]-3,4-dihydro-2H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 29148983 |
| Molecular Formula | C24H23FN2O3S |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 1-(4-fluorobenzoyl)-N-[(1R)-1-phenylethyl]-3,4-dihydro-2H-quinoline-6-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc2c(c1)CCCN2C(=O)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H23FN2O3S/c1-17(18-6-3-2-4-7-18)26-31(29,30)22-13-14-23-20(16-22)8-5-15-27(23)24(28)19-9-11-21(25)12-10-19/h2-4,6-7,9-14,16-17,26H,5,8,15H2,1H3/t17-/m1/s1 |
| InChIKey | POXGGJIQRLIREU-QGZVFWFLSA-N |
| XLogP | 4.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |