About ethyl 2-[2-(2-benzamido-4-methylpentanoyl)oxybutanoylamino]-4-methyl-1,3-thiazole-5-carboxylate
ethyl 2-[2-(2-benzamido-4-methylpentanoyl)oxybutanoylamino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 2915100) has the molecular formula C24H31N3O6S
and a molecular weight of 489.59 g/mol. Its IUPAC name is ethyl 2-[2-(2-benzamido-4-methylpentanoyl)oxybutanoylamino]-4-methyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[2-(2-benzamido-4-methylpentanoyl)oxybutanoylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 2915100 |
| Molecular Formula | C24H31N3O6S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | ethyl 2-[2-(2-benzamido-4-methylpentanoyl)oxybutanoylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)C(CC)OC(=O)C(CC(C)C)NC(=O)c2ccccc2)nc1C |
| InChI | InChI=1S/C24H31N3O6S/c1-6-18(21(29)27-24-25-15(5)19(34-24)23(31)32-7-2)33-22(30)17(13-14(3)4)26-20(28)16-11-9-8-10-12-16/h8-12,14,17-18H,6-7,13H2,1-5H3,(H,26,28)(H,25,27,29) |
| InChIKey | NDSDAZLQEHREEM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 2-[2-(2-benzamido-4-methylpentanoyl)oxybutanoylamino]-4-methyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-(2-benzamido-4-methylpentanoyl)oxybutanoylamino]-4-methyl-1,3-thiazole-5-carboxylate?
The IUPAC name of ethyl 2-[2-(2-benzamido-4-methylpentanoyl)oxybutanoylamino]-4-methyl-1,3-thiazole-5-carboxylate (CID 2915100) is ethyl 2-[2-(2-benzamido-4-methylpentanoyl)oxybutanoylamino]-4-methyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for ethyl 2-[2-(2-benzamido-4-methylpentanoyl)oxybutanoylamino]-4-methyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for ethyl 2-[2-(2-benzamido-4-methylpentanoyl)oxybutanoylamino]-4-methyl-1,3-thiazole-5-carboxylate is CCOC(=O)c1sc(NC(=O)C(CC)OC(=O)C(CC(C)C)NC(=O)c2ccccc2)nc1C.
What is the InChIKey of ethyl 2-[2-(2-benzamido-4-methylpentanoyl)oxybutanoylamino]-4-methyl-1,3-thiazole-5-carboxylate?
The InChIKey is NDSDAZLQEHREEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31N3O6S/c1-6-18(21(29)27-24-25-15(5)19(34-24)23(31)32-7-2)33-22(30)17(13-14(3)4)26-20(28)16-11-9-8-10-12-16/h8-12,14,17-18H,6-7,13H2,1-5H3,(H,26,28)(H,25,27,29).
What are the key properties of ethyl 2-[2-(2-benzamido-4-methylpentanoyl)oxybutanoylamino]-4-methyl-1,3-thiazole-5-carboxylate?
ethyl 2-[2-(2-benzamido-4-methylpentanoyl)oxybutanoylamino]-4-methyl-1,3-thiazole-5-carboxylate has a molecular weight of 489.59 g/mol, XLogP of 3.73, 11 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-(2-benzamido-4-methylpentanoyl)oxybutanoylamino]-4-methyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 2915100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).