C24H29N5O2 — CID 29152515
N-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazol-4-yl]methyl]-2-(4-methyl-5,6,7,8-tetrahydroquinazolin-2-yl)ethanamine (PubChem CID 29152515) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazol-4-yl]methyl]-2-(4-methyl-5,6,7,8-tetrahydroquinazolin-2-yl)ethanamine.
| Compound Name | N-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazol-4-yl]methyl]-2-(4-methyl-5,6,7,8-tetrahydroquinazolin-2-yl)ethanamine |
|---|---|
| PubChem CID | 29152515 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-methylpyrazol-4-yl]methyl]-2-(4-methyl-5,6,7,8-tetrahydroquinazolin-2-yl)ethanamine |
| SMILES | Cc1nc(CCNCc2cn(C)nc2-c2ccc3c(c2)OCCO3)nc2c1CCCC2 |
| InChI | InChI=1S/C24H29N5O2/c1-16-19-5-3-4-6-20(19)27-23(26-16)9-10-25-14-18-15-29(2)28-24(18)17-7-8-21-22(13-17)31-12-11-30-21/h7-8,13,15,25H,3-6,9-12,14H2,1-2H3 |
| InChIKey | CMZCWFXCBOIQSY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|