About 2-[1-[[(3S)-1-(1,3-benzothiazol-2-ylmethyl)piperidin-3-yl]methyl]triazol-4-yl]ethanol
2-[1-[[(3S)-1-(1,3-benzothiazol-2-ylmethyl)piperidin-3-yl]methyl]triazol-4-yl]ethanol (PubChem CID 29153419) has the molecular formula C18H23N5OS
and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-[1-[[(3S)-1-(1,3-benzothiazol-2-ylmethyl)piperidin-3-yl]methyl]triazol-4-yl]ethanol.
Molecular Properties
| Compound Name | 2-[1-[[(3S)-1-(1,3-benzothiazol-2-ylmethyl)piperidin-3-yl]methyl]triazol-4-yl]ethanol |
| PubChem CID | 29153419 |
| Molecular Formula | C18H23N5OS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-[1-[[(3S)-1-(1,3-benzothiazol-2-ylmethyl)piperidin-3-yl]methyl]triazol-4-yl]ethanol |
| SMILES | OCCc1cn(C[C@H]2CCCN(Cc3nc4ccccc4s3)C2)nn1 |
| InChI | InChI=1S/C18H23N5OS/c24-9-7-15-12-23(21-20-15)11-14-4-3-8-22(10-14)13-18-19-16-5-1-2-6-17(16)25-18/h1-2,5-6,12,14,24H,3-4,7-11,13H2/t14-/m0/s1 |
| InChIKey | XVBKEADKZYOTGR-AWEZNQCLSA-N |
| XLogP | 2.33 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[1-[[(3S)-1-(1,3-benzothiazol-2-ylmethyl)piperidin-3-yl]methyl]triazol-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[[(3S)-1-(1,3-benzothiazol-2-ylmethyl)piperidin-3-yl]methyl]triazol-4-yl]ethanol?
The IUPAC name of 2-[1-[[(3S)-1-(1,3-benzothiazol-2-ylmethyl)piperidin-3-yl]methyl]triazol-4-yl]ethanol (CID 29153419) is 2-[1-[[(3S)-1-(1,3-benzothiazol-2-ylmethyl)piperidin-3-yl]methyl]triazol-4-yl]ethanol.
What is the SMILES notation for 2-[1-[[(3S)-1-(1,3-benzothiazol-2-ylmethyl)piperidin-3-yl]methyl]triazol-4-yl]ethanol?
The canonical SMILES for 2-[1-[[(3S)-1-(1,3-benzothiazol-2-ylmethyl)piperidin-3-yl]methyl]triazol-4-yl]ethanol is OCCc1cn(C[C@H]2CCCN(Cc3nc4ccccc4s3)C2)nn1.
What is the InChIKey of 2-[1-[[(3S)-1-(1,3-benzothiazol-2-ylmethyl)piperidin-3-yl]methyl]triazol-4-yl]ethanol?
The InChIKey is XVBKEADKZYOTGR-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H23N5OS/c24-9-7-15-12-23(21-20-15)11-14-4-3-8-22(10-14)13-18-19-16-5-1-2-6-17(16)25-18/h1-2,5-6,12,14,24H,3-4,7-11,13H2/t14-/m0/s1.
What are the key properties of 2-[1-[[(3S)-1-(1,3-benzothiazol-2-ylmethyl)piperidin-3-yl]methyl]triazol-4-yl]ethanol?
2-[1-[[(3S)-1-(1,3-benzothiazol-2-ylmethyl)piperidin-3-yl]methyl]triazol-4-yl]ethanol has a molecular weight of 357.48 g/mol, XLogP of 2.33, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[[(3S)-1-(1,3-benzothiazol-2-ylmethyl)piperidin-3-yl]methyl]triazol-4-yl]ethanol is sourced from PubChem (CID 29153419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).