About ethyl 4-[(3R)-1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate
ethyl 4-[(3R)-1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate (PubChem CID 29153603) has the molecular formula C18H31N5O2
and a molecular weight of 349.48 g/mol. Its IUPAC name is ethyl 4-[(3R)-1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(3R)-1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate |
| PubChem CID | 29153603 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | ethyl 4-[(3R)-1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN([C@@H]2CCCN(Cc3cnn(C)c3C)C2)CC1 |
| InChI | InChI=1S/C18H31N5O2/c1-4-25-18(24)23-10-8-22(9-11-23)17-6-5-7-21(14-17)13-16-12-19-20(3)15(16)2/h12,17H,4-11,13-14H2,1-3H3/t17-/m1/s1 |
| InChIKey | JZSAXGCWTIQOMG-QGZVFWFLSA-N |
| XLogP | 1.47 |
| TPSA | 53.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[(3R)-1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(3R)-1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[(3R)-1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate (CID 29153603) is ethyl 4-[(3R)-1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[(3R)-1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[(3R)-1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate is CCOC(=O)N1CCN([C@@H]2CCCN(Cc3cnn(C)c3C)C2)CC1.
What is the InChIKey of ethyl 4-[(3R)-1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate?
The InChIKey is JZSAXGCWTIQOMG-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H31N5O2/c1-4-25-18(24)23-10-8-22(9-11-23)17-6-5-7-21(14-17)13-16-12-19-20(3)15(16)2/h12,17H,4-11,13-14H2,1-3H3/t17-/m1/s1.
What are the key properties of ethyl 4-[(3R)-1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate?
ethyl 4-[(3R)-1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate has a molecular weight of 349.48 g/mol, XLogP of 1.47, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(3R)-1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine-1-carboxylate is sourced from PubChem (CID 29153603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).