C19H30N2O3 — CID 29154220
5-[[(3S)-4-cyclopentyl-3-(2-hydroxyethyl)piperazin-1-yl]methyl]-2-methoxyphenol (PubChem CID 29154220) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 5-[[(3S)-4-cyclopentyl-3-(2-hydroxyethyl)piperazin-1-yl]methyl]-2-methoxyphenol.
| Compound Name | 5-[[(3S)-4-cyclopentyl-3-(2-hydroxyethyl)piperazin-1-yl]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 29154220 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 5-[[(3S)-4-cyclopentyl-3-(2-hydroxyethyl)piperazin-1-yl]methyl]-2-methoxyphenol |
| SMILES | COc1ccc(CN2CCN(C3CCCC3)[C@@H](CCO)C2)cc1O |
| InChI | InChI=1S/C19H30N2O3/c1-24-19-7-6-15(12-18(19)23)13-20-9-10-21(16-4-2-3-5-16)17(14-20)8-11-22/h6-7,12,16-17,22-23H,2-5,8-11,13-14H2,1H3/t17-/m0/s1 |
| InChIKey | LFAOWCVIVNHESI-KRWDZBQOSA-N |
| XLogP | 2.21 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |