C21H30N4O4S2 — CID 29154696
3-[5-[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-oxadiazol-2-yl]-N,N-diethylbenzenesulfonamide (PubChem CID 29154696) has the molecular formula C21H30N4O4S2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 3-[5-[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-oxadiazol-2-yl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-[5-[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-oxadiazol-2-yl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 29154696 |
| Molecular Formula | C21H30N4O4S2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 3-[5-[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-oxadiazol-2-yl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nnc(SCC(=O)N3C[C@H](C)C[C@H](C)C3)o2)c1 |
| InChI | InChI=1S/C21H30N4O4S2/c1-5-25(6-2)31(27,28)18-9-7-8-17(11-18)20-22-23-21(29-20)30-14-19(26)24-12-15(3)10-16(4)13-24/h7-9,11,15-16H,5-6,10,12-14H2,1-4H3/t15-,16+ |
| InChIKey | AONUTTDQAAWBOA-IYBDPMFKSA-N |
| XLogP | 3.36 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |