About 3-phenyl-N-(1,3-thiazol-2-yl)butanamide
3-phenyl-N-(1,3-thiazol-2-yl)butanamide (PubChem CID 2915589) has the molecular formula C13H14N2OS
and a molecular weight of 246.34 g/mol. Its IUPAC name is 3-phenyl-N-(1,3-thiazol-2-yl)butanamide.
Molecular Properties
| Compound Name | 3-phenyl-N-(1,3-thiazol-2-yl)butanamide |
| PubChem CID | 2915589 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 3-phenyl-N-(1,3-thiazol-2-yl)butanamide |
| SMILES | CC(CC(=O)Nc1nccs1)c1ccccc1 |
| InChI | InChI=1S/C13H14N2OS/c1-10(11-5-3-2-4-6-11)9-12(16)15-13-14-7-8-17-13/h2-8,10H,9H2,1H3,(H,14,15,16) |
| InChIKey | NLVYETCQEBKMAZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-phenyl-N-(1,3-thiazol-2-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-N-(1,3-thiazol-2-yl)butanamide?
The IUPAC name of 3-phenyl-N-(1,3-thiazol-2-yl)butanamide (CID 2915589) is 3-phenyl-N-(1,3-thiazol-2-yl)butanamide.
What is the SMILES notation for 3-phenyl-N-(1,3-thiazol-2-yl)butanamide?
The canonical SMILES for 3-phenyl-N-(1,3-thiazol-2-yl)butanamide is CC(CC(=O)Nc1nccs1)c1ccccc1.
What is the InChIKey of 3-phenyl-N-(1,3-thiazol-2-yl)butanamide?
The InChIKey is NLVYETCQEBKMAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2OS/c1-10(11-5-3-2-4-6-11)9-12(16)15-13-14-7-8-17-13/h2-8,10H,9H2,1H3,(H,14,15,16).
What are the key properties of 3-phenyl-N-(1,3-thiazol-2-yl)butanamide?
3-phenyl-N-(1,3-thiazol-2-yl)butanamide has a molecular weight of 246.34 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-N-(1,3-thiazol-2-yl)butanamide is sourced from PubChem (CID 2915589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).