C16H18F2N2O2 — CID 29158100
(3R)-1-(3,4-difluorophenyl)-3-[(3S)-3-methylpiperidin-1-yl]pyrrolidine-2,5-dione (PubChem CID 29158100) has the molecular formula C16H18F2N2O2 and a molecular weight of 308.33 g/mol. Its IUPAC name is (3R)-1-(3,4-difluorophenyl)-3-[(3S)-3-methylpiperidin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(3,4-difluorophenyl)-3-[(3S)-3-methylpiperidin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 29158100 |
| Molecular Formula | C16H18F2N2O2 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (3R)-1-(3,4-difluorophenyl)-3-[(3S)-3-methylpiperidin-1-yl]pyrrolidine-2,5-dione |
| SMILES | C[C@H]1CCCN([C@@H]2CC(=O)N(c3ccc(F)c(F)c3)C2=O)C1 |
| InChI | InChI=1S/C16H18F2N2O2/c1-10-3-2-6-19(9-10)14-8-15(21)20(16(14)22)11-4-5-12(17)13(18)7-11/h4-5,7,10,14H,2-3,6,8-9H2,1H3/t10-,14+/m0/s1 |
| InChIKey | UPPUPRYAOMKZAB-IINYFYTJSA-N |
| XLogP | 2.33 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|