C10H9N5OS — CID 29158612
(4R)-6-amino-2-sulfanylidenespiro[1,3-dihydro-1,3,5-triazine-4,3'-1H-indole]-2'-one (PubChem CID 29158612) has the molecular formula C10H9N5OS and a molecular weight of 247.28 g/mol. Its IUPAC name is (4R)-6-amino-2-sulfanylidenespiro[1,3-dihydro-1,3,5-triazine-4,3'-1H-indole]-2'-one.
| Compound Name | (4R)-6-amino-2-sulfanylidenespiro[1,3-dihydro-1,3,5-triazine-4,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 29158612 |
| Molecular Formula | C10H9N5OS |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | (4R)-6-amino-2-sulfanylidenespiro[1,3-dihydro-1,3,5-triazine-4,3'-1H-indole]-2'-one |
| SMILES | NC1=N[C@@]2(NC(=S)N1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C10H9N5OS/c11-8-13-9(17)15-10(14-8)5-3-1-2-4-6(5)12-7(10)16/h1-4H,(H,12,16)(H4,11,13,14,15,17)/t10-/m0/s1 |
| InChIKey | QOIFBKBGOMEKBL-JTQLQIEISA-N |
| XLogP | -0.42 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|