About 1,1-dimethylindene
1,1-dimethylindene (PubChem CID 29160) has the molecular formula C11H12
and a molecular weight of 144.22 g/mol. Its IUPAC name is 1,1-dimethylindene.
Molecular Properties
| Compound Name | 1,1-dimethylindene |
| PubChem CID | 29160 |
| Molecular Formula | C11H12 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 1,1-dimethylindene |
| SMILES | CC1(C)C=Cc2ccccc21 |
| InChI | InChI=1S/C11H12/c1-11(2)8-7-9-5-3-4-6-10(9)11/h3-8H,1-2H3 |
| InChIKey | HVBHEPYJVAMWCY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-dimethylindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethylindene?
The IUPAC name of 1,1-dimethylindene (CID 29160) is 1,1-dimethylindene.
What is the SMILES notation for 1,1-dimethylindene?
The canonical SMILES for 1,1-dimethylindene is CC1(C)C=Cc2ccccc21.
What is the InChIKey of 1,1-dimethylindene?
The InChIKey is HVBHEPYJVAMWCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12/c1-11(2)8-7-9-5-3-4-6-10(9)11/h3-8H,1-2H3.
What are the key properties of 1,1-dimethylindene?
1,1-dimethylindene has a molecular weight of 144.22 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethylindene is sourced from PubChem (CID 29160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).