C21H21F3N2O3 — CID 2916844
1-[5-hydroxy-3-(3-methoxyphenyl)-5-(trifluoromethyl)-4H-pyrazol-1-yl]-4-phenylbutan-1-one (PubChem CID 2916844) has the molecular formula C21H21F3N2O3 and a molecular weight of 406.40 g/mol. Its IUPAC name is 1-[5-hydroxy-3-(3-methoxyphenyl)-5-(trifluoromethyl)-4H-pyrazol-1-yl]-4-phenylbutan-1-one.
| Compound Name | 1-[5-hydroxy-3-(3-methoxyphenyl)-5-(trifluoromethyl)-4H-pyrazol-1-yl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 2916844 |
| Molecular Formula | C21H21F3N2O3 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 1-[5-hydroxy-3-(3-methoxyphenyl)-5-(trifluoromethyl)-4H-pyrazol-1-yl]-4-phenylbutan-1-one |
| SMILES | COc1cccc(C2=NN(C(=O)CCCc3ccccc3)C(O)(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C21H21F3N2O3/c1-29-17-11-6-10-16(13-17)18-14-20(28,21(22,23)24)26(25-18)19(27)12-5-9-15-7-3-2-4-8-15/h2-4,6-8,10-11,13,28H,5,9,12,14H2,1H3 |
| InChIKey | VJEHSGUGRKQYJY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |