C17H16BrNO — CID 2917145
1-(4-bromophenyl)-3-(2,5-dimethylanilino)prop-2-en-1-one (PubChem CID 2917145) has the molecular formula C17H16BrNO and a molecular weight of 330.23 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(2,5-dimethylanilino)prop-2-en-1-one.
| Compound Name | 1-(4-bromophenyl)-3-(2,5-dimethylanilino)prop-2-en-1-one |
|---|---|
| PubChem CID | 2917145 |
| Molecular Formula | C17H16BrNO |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 1-(4-bromophenyl)-3-(2,5-dimethylanilino)prop-2-en-1-one |
| SMILES | Cc1ccc(C)c(NC=CC(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C17H16BrNO/c1-12-3-4-13(2)16(11-12)19-10-9-17(20)14-5-7-15(18)8-6-14/h3-11,19H,1-2H3 |
| InChIKey | FDKWYMDCNSPACL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|