C19H24N4O2 — CID 29173424
4-[2-[2-(5-propyl-1,3,4-oxadiazol-2-yl)indol-1-yl]ethyl]morpholine (PubChem CID 29173424) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 4-[2-[2-(5-propyl-1,3,4-oxadiazol-2-yl)indol-1-yl]ethyl]morpholine.
| Compound Name | 4-[2-[2-(5-propyl-1,3,4-oxadiazol-2-yl)indol-1-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 29173424 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 4-[2-[2-(5-propyl-1,3,4-oxadiazol-2-yl)indol-1-yl]ethyl]morpholine |
| SMILES | CCCc1nnc(-c2cc3ccccc3n2CCN2CCOCC2)o1 |
| InChI | InChI=1S/C19H24N4O2/c1-2-5-18-20-21-19(25-18)17-14-15-6-3-4-7-16(15)23(17)9-8-22-10-12-24-13-11-22/h3-4,6-7,14H,2,5,8-13H2,1H3 |
| InChIKey | CNXGLKZAFYXFSR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 56.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |