C17H23N3O2S — CID 2917827
N,6-dimethyl-4-[4-(2-methylpropoxy)phenyl]-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 2917827) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is N,6-dimethyl-4-[4-(2-methylpropoxy)phenyl]-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | N,6-dimethyl-4-[4-(2-methylpropoxy)phenyl]-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 2917827 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N,6-dimethyl-4-[4-(2-methylpropoxy)phenyl]-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CNC(=O)C1=C(C)NC(=S)NC1c1ccc(OCC(C)C)cc1 |
| InChI | InChI=1S/C17H23N3O2S/c1-10(2)9-22-13-7-5-12(6-8-13)15-14(16(21)18-4)11(3)19-17(23)20-15/h5-8,10,15H,9H2,1-4H3,(H,18,21)(H2,19,20,23) |
| InChIKey | AXBTZUOSJKEQKA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|