About 2-propan-2-yloxybutane
2-propan-2-yloxybutane (PubChem CID 29179) has the molecular formula C7H16O
and a molecular weight of 116.20 g/mol. Its IUPAC name is 2-propan-2-yloxybutane.
Molecular Properties
| Compound Name | 2-propan-2-yloxybutane |
| PubChem CID | 29179 |
| Molecular Formula | C7H16O |
| Molecular Weight | 116.20 g/mol |
| Exact Mass | 116.12 |
| IUPAC Name | 2-propan-2-yloxybutane |
| SMILES | CCC(C)OC(C)C |
| InChI | InChI=1S/C7H16O/c1-5-7(4)8-6(2)3/h6-7H,5H2,1-4H3 |
| InChIKey | QHJLNXCHSKDYHR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-propan-2-yloxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yloxybutane?
The IUPAC name of 2-propan-2-yloxybutane (CID 29179) is 2-propan-2-yloxybutane.
What is the SMILES notation for 2-propan-2-yloxybutane?
The canonical SMILES for 2-propan-2-yloxybutane is CCC(C)OC(C)C.
What is the InChIKey of 2-propan-2-yloxybutane?
The InChIKey is QHJLNXCHSKDYHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O/c1-5-7(4)8-6(2)3/h6-7H,5H2,1-4H3.
What are the key properties of 2-propan-2-yloxybutane?
2-propan-2-yloxybutane has a molecular weight of 116.20 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxybutane is sourced from PubChem (CID 29179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).