C22H22N6O — CID 29181415
5-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole (PubChem CID 29181415) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is 5-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole.
| Compound Name | 5-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 29181415 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 5-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole |
| SMILES | Cc1cc(C)n(-c2ccc(-c3nc(-c4c(C)ncc5c4CCNC5)no3)cc2)n1 |
| InChI | InChI=1S/C22H22N6O/c1-13-10-14(2)28(26-13)18-6-4-16(5-7-18)22-25-21(27-29-22)20-15(3)24-12-17-11-23-9-8-19(17)20/h4-7,10,12,23H,8-9,11H2,1-3H3 |
| InChIKey | SXPJMSDBSDUVKU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |