About 4-[3-[1-(1,3-thiazol-2-ylmethyl)pyrazol-3-yl]phenyl]furo[3,2-c]pyridine
4-[3-[1-(1,3-thiazol-2-ylmethyl)pyrazol-3-yl]phenyl]furo[3,2-c]pyridine (PubChem CID 29182414) has the molecular formula C20H14N4OS
and a molecular weight of 358.43 g/mol. Its IUPAC name is 4-[3-[1-(1,3-thiazol-2-ylmethyl)pyrazol-3-yl]phenyl]furo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 4-[3-[1-(1,3-thiazol-2-ylmethyl)pyrazol-3-yl]phenyl]furo[3,2-c]pyridine |
| PubChem CID | 29182414 |
| Molecular Formula | C20H14N4OS |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 4-[3-[1-(1,3-thiazol-2-ylmethyl)pyrazol-3-yl]phenyl]furo[3,2-c]pyridine |
| SMILES | c1cc(-c2ccn(Cc3nccs3)n2)cc(-c2nccc3occc23)c1 |
| InChI | InChI=1S/C20H14N4OS/c1-2-14(17-5-9-24(23-17)13-19-21-8-11-26-19)12-15(3-1)20-16-6-10-25-18(16)4-7-22-20/h1-12H,13H2 |
| InChIKey | GSUMJYXZKYKMKQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[3-[1-(1,3-thiazol-2-ylmethyl)pyrazol-3-yl]phenyl]furo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[1-(1,3-thiazol-2-ylmethyl)pyrazol-3-yl]phenyl]furo[3,2-c]pyridine?
The IUPAC name of 4-[3-[1-(1,3-thiazol-2-ylmethyl)pyrazol-3-yl]phenyl]furo[3,2-c]pyridine (CID 29182414) is 4-[3-[1-(1,3-thiazol-2-ylmethyl)pyrazol-3-yl]phenyl]furo[3,2-c]pyridine.
What is the SMILES notation for 4-[3-[1-(1,3-thiazol-2-ylmethyl)pyrazol-3-yl]phenyl]furo[3,2-c]pyridine?
The canonical SMILES for 4-[3-[1-(1,3-thiazol-2-ylmethyl)pyrazol-3-yl]phenyl]furo[3,2-c]pyridine is c1cc(-c2ccn(Cc3nccs3)n2)cc(-c2nccc3occc23)c1.
What is the InChIKey of 4-[3-[1-(1,3-thiazol-2-ylmethyl)pyrazol-3-yl]phenyl]furo[3,2-c]pyridine?
The InChIKey is GSUMJYXZKYKMKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N4OS/c1-2-14(17-5-9-24(23-17)13-19-21-8-11-26-19)12-15(3-1)20-16-6-10-25-18(16)4-7-22-20/h1-12H,13H2.
What are the key properties of 4-[3-[1-(1,3-thiazol-2-ylmethyl)pyrazol-3-yl]phenyl]furo[3,2-c]pyridine?
4-[3-[1-(1,3-thiazol-2-ylmethyl)pyrazol-3-yl]phenyl]furo[3,2-c]pyridine has a molecular weight of 358.43 g/mol, XLogP of 4.86, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[1-(1,3-thiazol-2-ylmethyl)pyrazol-3-yl]phenyl]furo[3,2-c]pyridine is sourced from PubChem (CID 29182414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).