C13H25N3S — CID 2918325
1-prop-2-enyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 2918325) has the molecular formula C13H25N3S and a molecular weight of 255.43 g/mol. Its IUPAC name is 1-prop-2-enyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 1-prop-2-enyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 2918325 |
| Molecular Formula | C13H25N3S |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 1-prop-2-enyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | C=CCNC(=S)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C13H25N3S/c1-6-7-14-11(17)15-10-8-12(2,3)16-13(4,5)9-10/h6,10,16H,1,7-9H2,2-5H3,(H2,14,15,17) |
| InChIKey | BPFYFWLGBXUUIZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|