C16H21N5O5 — CID 2918356
N-methyl-N'-[2-[4-(4-nitrobenzoyl)piperazin-1-yl]ethyl]oxamide (PubChem CID 2918356) has the molecular formula C16H21N5O5 and a molecular weight of 363.37 g/mol. Its IUPAC name is N-methyl-N'-[2-[4-(4-nitrobenzoyl)piperazin-1-yl]ethyl]oxamide.
| Compound Name | N-methyl-N'-[2-[4-(4-nitrobenzoyl)piperazin-1-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 2918356 |
| Molecular Formula | C16H21N5O5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-methyl-N'-[2-[4-(4-nitrobenzoyl)piperazin-1-yl]ethyl]oxamide |
| SMILES | CNC(=O)C(=O)NCCN1CCN(C(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C16H21N5O5/c1-17-14(22)15(23)18-6-7-19-8-10-20(11-9-19)16(24)12-2-4-13(5-3-12)21(25)26/h2-5H,6-11H2,1H3,(H,17,22)(H,18,23) |
| InChIKey | XXVLRUWMRIMQDD-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|