About ethyl 4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride
ethyl 4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride (PubChem CID 2918425) has the molecular formula C16H23Cl3N2O4
and a molecular weight of 413.73 g/mol. Its IUPAC name is ethyl 4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride |
| PubChem CID | 2918425 |
| Molecular Formula | C16H23Cl3N2O4 |
| Molecular Weight | 413.73 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | ethyl 4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride |
| SMILES | CCOC(=O)N1CCN(CC(O)COc2ccc(Cl)cc2Cl)CC1.Cl |
| InChI | InChI=1S/C16H22Cl2N2O4.ClH/c1-2-23-16(22)20-7-5-19(6-8-20)10-13(21)11-24-15-4-3-12(17)9-14(15)18;/h3-4,9,13,21H,2,5-8,10-11H2,1H3;1H |
| InChIKey | HQDVNDZJNRYEKB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.73 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride?
The IUPAC name of ethyl 4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride (CID 2918425) is ethyl 4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride.
What is the SMILES notation for ethyl 4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride?
The canonical SMILES for ethyl 4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride is CCOC(=O)N1CCN(CC(O)COc2ccc(Cl)cc2Cl)CC1.Cl.
What is the InChIKey of ethyl 4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride?
The InChIKey is HQDVNDZJNRYEKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22Cl2N2O4.ClH/c1-2-23-16(22)20-7-5-19(6-8-20)10-13(21)11-24-15-4-3-12(17)9-14(15)18;/h3-4,9,13,21H,2,5-8,10-11H2,1H3;1H.
What are the key properties of ethyl 4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride?
ethyl 4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride has a molecular weight of 413.73 g/mol, XLogP of 2.93, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride is sourced from PubChem (CID 2918425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).