C23H29FN2O2 — CID 29184698
1-[(4aR,8aS)-1-(cyclohexene-1-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(2-fluorophenyl)ethanone (PubChem CID 29184698) has the molecular formula C23H29FN2O2 and a molecular weight of 384.50 g/mol. Its IUPAC name is 1-[(4aR,8aS)-1-(cyclohexene-1-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(2-fluorophenyl)ethanone.
| Compound Name | 1-[(4aR,8aS)-1-(cyclohexene-1-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 29184698 |
| Molecular Formula | C23H29FN2O2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 1-[(4aR,8aS)-1-(cyclohexene-1-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(2-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccccc1F)N1CC[C@H]2[C@H](CCCN2C(=O)C2=CCCCC2)C1 |
| InChI | InChI=1S/C23H29FN2O2/c24-20-11-5-4-9-18(20)15-22(27)25-14-12-21-19(16-25)10-6-13-26(21)23(28)17-7-2-1-3-8-17/h4-5,7,9,11,19,21H,1-3,6,8,10,12-16H2/t19-,21+/m1/s1 |
| InChIKey | IYBKJQHSBFIAFZ-CTNGQTDRSA-N |
| XLogP | 3.71 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |