C25H31FN4O2 — CID 29184784
(3S)-N-(3,4-dimethoxyphenyl)-1-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl]piperidin-3-amine (PubChem CID 29184784) has the molecular formula C25H31FN4O2 and a molecular weight of 438.55 g/mol. Its IUPAC name is (3S)-N-(3,4-dimethoxyphenyl)-1-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl]piperidin-3-amine.
| Compound Name | (3S)-N-(3,4-dimethoxyphenyl)-1-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 29184784 |
| Molecular Formula | C25H31FN4O2 |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | (3S)-N-(3,4-dimethoxyphenyl)-1-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl]piperidin-3-amine |
| SMILES | COc1ccc(N[C@H]2CCCN(Cc3cc(F)ccc3-n3nc(C)cc3C)C2)cc1OC |
| InChI | InChI=1S/C25H31FN4O2/c1-17-12-18(2)30(28-17)23-9-7-20(26)13-19(23)15-29-11-5-6-22(16-29)27-21-8-10-24(31-3)25(14-21)32-4/h7-10,12-14,22,27H,5-6,11,15-16H2,1-4H3/t22-/m0/s1 |
| InChIKey | UKUYWCMBHCGZGE-QFIPXVFZSA-N |
| XLogP | 4.72 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|