C20H18N6 — CID 29185101
2-N-benzyl-6-(8-methylquinolin-5-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 29185101) has the molecular formula C20H18N6 and a molecular weight of 342.41 g/mol. Its IUPAC name is 2-N-benzyl-6-(8-methylquinolin-5-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-benzyl-6-(8-methylquinolin-5-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 29185101 |
| Molecular Formula | C20H18N6 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-N-benzyl-6-(8-methylquinolin-5-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(-c2nc(N)nc(NCc3ccccc3)n2)c2cccnc12 |
| InChI | InChI=1S/C20H18N6/c1-13-9-10-16(15-8-5-11-22-17(13)15)18-24-19(21)26-20(25-18)23-12-14-6-3-2-4-7-14/h2-11H,12H2,1H3,(H3,21,23,24,25,26) |
| InChIKey | HTORMMJHYZJHDZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |