About N-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide
N-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 2918564) has the molecular formula C11H14N2S
and a molecular weight of 206.31 g/mol. Its IUPAC name is N-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
Molecular Properties
| Compound Name | N-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| PubChem CID | 2918564 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | N-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | CNC(=S)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C11H14N2S/c1-12-11(14)13-7-6-9-4-2-3-5-10(9)8-13/h2-5H,6-8H2,1H3,(H,12,14) |
| InChIKey | JVKOZUOEFQVOMI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide?
The IUPAC name of N-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide (CID 2918564) is N-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
What is the SMILES notation for N-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide?
The canonical SMILES for N-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide is CNC(=S)N1CCc2ccccc2C1.
What is the InChIKey of N-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide?
The InChIKey is JVKOZUOEFQVOMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2S/c1-12-11(14)13-7-6-9-4-2-3-5-10(9)8-13/h2-5H,6-8H2,1H3,(H,12,14).
What are the key properties of N-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide?
N-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide has a molecular weight of 206.31 g/mol, XLogP of 1.55, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide is sourced from PubChem (CID 2918564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).