C20H26ClNO2 — CID 29187187
(2R)-N-[[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]butan-2-amine (PubChem CID 29187187) has the molecular formula C20H26ClNO2 and a molecular weight of 347.89 g/mol. Its IUPAC name is (2R)-N-[[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]butan-2-amine.
| Compound Name | (2R)-N-[[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]butan-2-amine |
|---|---|
| PubChem CID | 29187187 |
| Molecular Formula | C20H26ClNO2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (2R)-N-[[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]butan-2-amine |
| SMILES | CC[C@@H](C)NCc1cc(Cl)c(OCc2ccc(C)cc2)c(OC)c1 |
| InChI | InChI=1S/C20H26ClNO2/c1-5-15(3)22-12-17-10-18(21)20(19(11-17)23-4)24-13-16-8-6-14(2)7-9-16/h6-11,15,22H,5,12-13H2,1-4H3/t15-/m1/s1 |
| InChIKey | SIWITLPQRYRIOE-OAHLLOKOSA-N |
| XLogP | 5.12 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |