C20H24ClNO2 — CID 29187254
N-[[5-chloro-2-[(4-methylphenyl)methoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine (PubChem CID 29187254) has the molecular formula C20H24ClNO2 and a molecular weight of 345.87 g/mol. Its IUPAC name is N-[[5-chloro-2-[(4-methylphenyl)methoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine.
| Compound Name | N-[[5-chloro-2-[(4-methylphenyl)methoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine |
|---|---|
| PubChem CID | 29187254 |
| Molecular Formula | C20H24ClNO2 |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-[[5-chloro-2-[(4-methylphenyl)methoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine |
| SMILES | Cc1ccc(COc2ccc(Cl)cc2CNC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C20H24ClNO2/c1-15-4-6-16(7-5-15)14-24-20-9-8-18(21)11-17(20)12-22-13-19-3-2-10-23-19/h4-9,11,19,22H,2-3,10,12-14H2,1H3/t19-/m1/s1 |
| InChIKey | FXDGAIDIQPYPGW-LJQANCHMSA-N |
| XLogP | 4.50 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |